yaidalizv013 yaidalizv013

20-07-2017
Biology

contestada

chlorofluorocarbons(CFCs) damage the ozone layer.Where do these chemicals come from?

Respuesta :

chrisy129 chrisy129

20-07-2017

Chlorofluorocarbons come from aerosol spray, refrigerators.

Answer Link

Otras preguntas

Diagrams and illustrations are _____. A. intended to show almost any type of geographical information B. used to present columns of numbers or survey statist

Calculate the molar mass of a compound from the following information. You find that the freezing point of benzene is 5.5 degrees C. You then dissolve 1.60 gram

Jacob is solving the equation below using successive approximations.2^x-4=3^-x-2 He started from a graph where he found the solution to be between 1 and 2. U

Calculate the molar mass of a compound from the following information. You find that the freezing point of benzene is 5.5 degrees C. You then dissolve 1.60 gram

A company purchased a delivery van for $23,000 with a salvage value of $3,000 on September 1, Year 1. It has an estimated useful life of 5 years. Using the stra

Hemisphere Corp. is considering a Build-Operator-Transfer (BOT) contract to construct and operate a large dam with a hydroelectric power generation facility in

¿Cuántos años...tú cuando aprendiste a nadar? a. tenía b. tuvo c. tienes d. tenías

in cell c5, enter a formula that uses a nested IF function to calculate the bonus. If sales in b5 are less $15,000, the sales person earns a 5% bonus. If the sa

What them does this following excerpt from franz kafka’s The metamorphosis deal with?

Identifica el complemento indirecto. Pablo Neruda dedicó un poema a la Señora.